C20H20N4O4 — CID 35708730
N'-[1-(furan-3-carbonyl)piperidine-4-carbonyl]-1H-indole-3-carbohydrazide (PubChem CID 35708730) has the molecular formula C20H20N4O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is N'-[1-(furan-3-carbonyl)piperidine-4-carbonyl]-1H-indole-3-carbohydrazide.
| Compound Name | N'-[1-(furan-3-carbonyl)piperidine-4-carbonyl]-1H-indole-3-carbohydrazide |
|---|---|
| PubChem CID | 35708730 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | N'-[1-(furan-3-carbonyl)piperidine-4-carbonyl]-1H-indole-3-carbohydrazide |
| SMILES | O=C(NNC(=O)C1CCN(C(=O)c2ccoc2)CC1)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C20H20N4O4/c25-18(13-5-8-24(9-6-13)20(27)14-7-10-28-12-14)22-23-19(26)16-11-21-17-4-2-1-3-15(16)17/h1-4,7,10-13,21H,5-6,8-9H2,(H,22,25)(H,23,26) |
| InChIKey | TVLJEEZGXNWWGH-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|