C20H21N5O3 — CID 11417616
N-[1-[5-(hydroxycarbamoyl)-2-pyridinyl]piperidin-4-yl]-1H-indole-3-carboxamide (PubChem CID 11417616) has the molecular formula C20H21N5O3 and a molecular weight of 379.42 g/mol. Its IUPAC name is N-[1-[5-(hydroxycarbamoyl)-2-pyridinyl]piperidin-4-yl]-1H-indole-3-carboxamide.
| Compound Name | N-[1-[5-(hydroxycarbamoyl)-2-pyridinyl]piperidin-4-yl]-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 11417616 |
| Molecular Formula | C20H21N5O3 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | N-[1-[5-(hydroxycarbamoyl)-2-pyridinyl]piperidin-4-yl]-1H-indole-3-carboxamide |
| SMILES | O=C(NO)c1ccc(N2CCC(NC(=O)c3c[nH]c4ccccc34)CC2)nc1 |
| InChI | InChI=1S/C20H21N5O3/c26-19(24-28)13-5-6-18(22-11-13)25-9-7-14(8-10-25)23-20(27)16-12-21-17-4-2-1-3-15(16)17/h1-6,11-12,14,21,28H,7-10H2,(H,23,27)(H,24,26) |
| InChIKey | KRBAPJMCRCQNBC-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 110.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|