C23H18N4O4 — CID 56545246
4-[4-[(1H-indole-3-carbonylamino)carbamoyl]phenoxy]benzamide (PubChem CID 56545246) has the molecular formula C23H18N4O4 and a molecular weight of 414.42 g/mol. Its IUPAC name is 4-[4-[(1H-indole-3-carbonylamino)carbamoyl]phenoxy]benzamide.
| Compound Name | 4-[4-[(1H-indole-3-carbonylamino)carbamoyl]phenoxy]benzamide |
|---|---|
| PubChem CID | 56545246 |
| Molecular Formula | C23H18N4O4 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | 4-[4-[(1H-indole-3-carbonylamino)carbamoyl]phenoxy]benzamide |
| SMILES | NC(=O)c1ccc(Oc2ccc(C(=O)NNC(=O)c3c[nH]c4ccccc34)cc2)cc1 |
| InChI | InChI=1S/C23H18N4O4/c24-21(28)14-5-9-16(10-6-14)31-17-11-7-15(8-12-17)22(29)26-27-23(30)19-13-25-20-4-2-1-3-18(19)20/h1-13,25H,(H2,24,28)(H,26,29)(H,27,30) |
| InChIKey | UIMXCHXWSFJNJB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 126.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|