C21H20FN5OS — CID 24643882
N-[3-(benzimidazol-1-yl)propyl]-3-(4-fluorophenyl)-2-methylsulfanylimidazole-4-carboxamide (PubChem CID 24643882) has the molecular formula C21H20FN5OS and a molecular weight of 409.49 g/mol. Its IUPAC name is N-[3-(benzimidazol-1-yl)propyl]-3-(4-fluorophenyl)-2-methylsulfanylimidazole-4-carboxamide.
| Compound Name | N-[3-(benzimidazol-1-yl)propyl]-3-(4-fluorophenyl)-2-methylsulfanylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 24643882 |
| Molecular Formula | C21H20FN5OS |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | N-[3-(benzimidazol-1-yl)propyl]-3-(4-fluorophenyl)-2-methylsulfanylimidazole-4-carboxamide |
| SMILES | CSc1ncc(C(=O)NCCCn2cnc3ccccc32)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C21H20FN5OS/c1-29-21-24-13-19(27(21)16-9-7-15(22)8-10-16)20(28)23-11-4-12-26-14-25-17-5-2-3-6-18(17)26/h2-3,5-10,13-14H,4,11-12H2,1H3,(H,23,28) |
| InChIKey | BRBDGCRWQKMQTH-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|