C19H21FN4O — CID 51274415
3-[3-(benzimidazol-1-yl)propyl]-1-[(4-fluorophenyl)methyl]-1-methylurea (PubChem CID 51274415) has the molecular formula C19H21FN4O and a molecular weight of 340.40 g/mol. Its IUPAC name is 3-[3-(benzimidazol-1-yl)propyl]-1-[(4-fluorophenyl)methyl]-1-methylurea.
| Compound Name | 3-[3-(benzimidazol-1-yl)propyl]-1-[(4-fluorophenyl)methyl]-1-methylurea |
|---|---|
| PubChem CID | 51274415 |
| Molecular Formula | C19H21FN4O |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 3-[3-(benzimidazol-1-yl)propyl]-1-[(4-fluorophenyl)methyl]-1-methylurea |
| SMILES | CN(Cc1ccc(F)cc1)C(=O)NCCCn1cnc2ccccc21 |
| InChI | InChI=1S/C19H21FN4O/c1-23(13-15-7-9-16(20)10-8-15)19(25)21-11-4-12-24-14-22-17-5-2-3-6-18(17)24/h2-3,5-10,14H,4,11-13H2,1H3,(H,21,25) |
| InChIKey | XQHMQSSESHEZAH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|