C19H20F2N4O — CID 134001610
3-[3-(benzimidazol-1-yl)propyl]-1-[(2,4-difluorophenyl)methyl]-1-methylurea (PubChem CID 134001610) has the molecular formula C19H20F2N4O and a molecular weight of 358.39 g/mol. Its IUPAC name is 3-[3-(benzimidazol-1-yl)propyl]-1-[(2,4-difluorophenyl)methyl]-1-methylurea.
| Compound Name | 3-[3-(benzimidazol-1-yl)propyl]-1-[(2,4-difluorophenyl)methyl]-1-methylurea |
|---|---|
| PubChem CID | 134001610 |
| Molecular Formula | C19H20F2N4O |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 3-[3-(benzimidazol-1-yl)propyl]-1-[(2,4-difluorophenyl)methyl]-1-methylurea |
| SMILES | CN(Cc1ccc(F)cc1F)C(=O)NCCCn1cnc2ccccc21 |
| InChI | InChI=1S/C19H20F2N4O/c1-24(12-14-7-8-15(20)11-16(14)21)19(26)22-9-4-10-25-13-23-17-5-2-3-6-18(17)25/h2-3,5-8,11,13H,4,9-10,12H2,1H3,(H,22,26) |
| InChIKey | DPONFFBLLGCCIA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|