C23H29N5O2 — CID 55457371
2-[3-(benzimidazol-1-yl)propylcarbamoyl-methylamino]-N-(2,4,6-trimethylphenyl)acetamide (PubChem CID 55457371) has the molecular formula C23H29N5O2 and a molecular weight of 407.52 g/mol. Its IUPAC name is 2-[3-(benzimidazol-1-yl)propylcarbamoyl-methylamino]-N-(2,4,6-trimethylphenyl)acetamide.
| Compound Name | 2-[3-(benzimidazol-1-yl)propylcarbamoyl-methylamino]-N-(2,4,6-trimethylphenyl)acetamide |
|---|---|
| PubChem CID | 55457371 |
| Molecular Formula | C23H29N5O2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | 2-[3-(benzimidazol-1-yl)propylcarbamoyl-methylamino]-N-(2,4,6-trimethylphenyl)acetamide |
| SMILES | Cc1cc(C)c(NC(=O)CN(C)C(=O)NCCCn2cnc3ccccc32)c(C)c1 |
| InChI | InChI=1S/C23H29N5O2/c1-16-12-17(2)22(18(3)13-16)26-21(29)14-27(4)23(30)24-10-7-11-28-15-25-19-8-5-6-9-20(19)28/h5-6,8-9,12-13,15H,7,10-11,14H2,1-4H3,(H,24,30)(H,26,29) |
| InChIKey | UUWKSEQJBUKDGH-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|