C17H21FN4OS — CID 78809507
3-(4-fluorophenyl)-N-(1-methylpiperidin-4-yl)-2-methylsulfanylimidazole-4-carboxamide (PubChem CID 78809507) has the molecular formula C17H21FN4OS and a molecular weight of 348.45 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-(1-methylpiperidin-4-yl)-2-methylsulfanylimidazole-4-carboxamide.
| Compound Name | 3-(4-fluorophenyl)-N-(1-methylpiperidin-4-yl)-2-methylsulfanylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 78809507 |
| Molecular Formula | C17H21FN4OS |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 3-(4-fluorophenyl)-N-(1-methylpiperidin-4-yl)-2-methylsulfanylimidazole-4-carboxamide |
| SMILES | CSc1ncc(C(=O)NC2CCN(C)CC2)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C17H21FN4OS/c1-21-9-7-13(8-10-21)20-16(23)15-11-19-17(24-2)22(15)14-5-3-12(18)4-6-14/h3-6,11,13H,7-10H2,1-2H3,(H,20,23) |
| InChIKey | JVRVXRPKGRITBE-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |