C16H18N4O — CID 51300917
6-[[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]amino]pyridine-3-carbonitrile (PubChem CID 51300917) has the molecular formula C16H18N4O and a molecular weight of 282.35 g/mol. Its IUPAC name is 6-[[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]amino]pyridine-3-carbonitrile.
| Compound Name | 6-[[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]amino]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 51300917 |
| Molecular Formula | C16H18N4O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 6-[[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]amino]pyridine-3-carbonitrile |
| SMILES | N#Cc1ccc(NCC(c2ccco2)N2CCCC2)nc1 |
| InChI | InChI=1S/C16H18N4O/c17-10-13-5-6-16(18-11-13)19-12-14(15-4-3-9-21-15)20-7-1-2-8-20/h3-6,9,11,14H,1-2,7-8,12H2,(H,18,19) |
| InChIKey | RWHTYBABLGWRFL-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |