C20H27N3OS — CID 8683309
1-(3,5-dimethylphenyl)-3-[(2S)-2-(furan-2-yl)-2-piperidin-1-ylethyl]thiourea (PubChem CID 8683309) has the molecular formula C20H27N3OS and a molecular weight of 357.52 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3-[(2S)-2-(furan-2-yl)-2-piperidin-1-ylethyl]thiourea.
| Compound Name | 1-(3,5-dimethylphenyl)-3-[(2S)-2-(furan-2-yl)-2-piperidin-1-ylethyl]thiourea |
|---|---|
| PubChem CID | 8683309 |
| Molecular Formula | C20H27N3OS |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3-[(2S)-2-(furan-2-yl)-2-piperidin-1-ylethyl]thiourea |
| SMILES | Cc1cc(C)cc(NC(=S)NC[C@@H](c2ccco2)N2CCCCC2)c1 |
| InChI | InChI=1S/C20H27N3OS/c1-15-11-16(2)13-17(12-15)22-20(25)21-14-18(19-7-6-10-24-19)23-8-4-3-5-9-23/h6-7,10-13,18H,3-5,8-9,14H2,1-2H3,(H2,21,22,25)/t18-/m0/s1 |
| InChIKey | SEBGXCSPIHPFIG-SFHVURJKSA-N |
| XLogP | 4.41 |
| TPSA | 40.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|