C18H22BrN3OS — CID 9235877
1-(3-bromophenyl)-3-[(2S)-2-(furan-2-yl)-2-piperidin-1-ylethyl]thiourea (PubChem CID 9235877) has the molecular formula C18H22BrN3OS and a molecular weight of 408.37 g/mol. Its IUPAC name is 1-(3-bromophenyl)-3-[(2S)-2-(furan-2-yl)-2-piperidin-1-ylethyl]thiourea.
| Compound Name | 1-(3-bromophenyl)-3-[(2S)-2-(furan-2-yl)-2-piperidin-1-ylethyl]thiourea |
|---|---|
| PubChem CID | 9235877 |
| Molecular Formula | C18H22BrN3OS |
| Molecular Weight | 408.37 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | 1-(3-bromophenyl)-3-[(2S)-2-(furan-2-yl)-2-piperidin-1-ylethyl]thiourea |
| SMILES | S=C(NC[C@@H](c1ccco1)N1CCCCC1)Nc1cccc(Br)c1 |
| InChI | InChI=1S/C18H22BrN3OS/c19-14-6-4-7-15(12-14)21-18(24)20-13-16(17-8-5-11-23-17)22-9-2-1-3-10-22/h4-8,11-12,16H,1-3,9-10,13H2,(H2,20,21,24)/t16-/m0/s1 |
| InChIKey | BDOCWEDHRPPLBD-INIZCTEOSA-N |
| XLogP | 4.56 |
| TPSA | 40.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.37 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|