C25H33N3O3 — CID 55648424
3-(cyclohexanecarbonylamino)-N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]benzamide (PubChem CID 55648424) has the molecular formula C25H33N3O3 and a molecular weight of 423.56 g/mol. Its IUPAC name is 3-(cyclohexanecarbonylamino)-N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]benzamide.
| Compound Name | 3-(cyclohexanecarbonylamino)-N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]benzamide |
|---|---|
| PubChem CID | 55648424 |
| Molecular Formula | C25H33N3O3 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | 3-(cyclohexanecarbonylamino)-N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]benzamide |
| SMILES | O=C(NCC(c1ccco1)N1CCCCC1)c1cccc(NC(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C25H33N3O3/c29-24(26-18-22(23-13-8-16-31-23)28-14-5-2-6-15-28)20-11-7-12-21(17-20)27-25(30)19-9-3-1-4-10-19/h7-8,11-13,16-17,19,22H,1-6,9-10,14-15,18H2,(H,26,29)(H,27,30) |
| InChIKey | RHCFAJXELCPXLE-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |