C19H29N3OS — CID 129420752
1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-[(2R)-2-(furan-2-yl)-2-piperidin-1-ylethyl]thiourea (PubChem CID 129420752) has the molecular formula C19H29N3OS and a molecular weight of 347.53 g/mol. Its IUPAC name is 1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-[(2R)-2-(furan-2-yl)-2-piperidin-1-ylethyl]thiourea.
| Compound Name | 1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-[(2R)-2-(furan-2-yl)-2-piperidin-1-ylethyl]thiourea |
|---|---|
| PubChem CID | 129420752 |
| Molecular Formula | C19H29N3OS |
| Molecular Weight | 347.53 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-[(2R)-2-(furan-2-yl)-2-piperidin-1-ylethyl]thiourea |
| SMILES | S=C(NC[C@H](c1ccco1)N1CCCCC1)N[C@@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C19H29N3OS/c24-19(21-16-12-14-6-7-15(16)11-14)20-13-17(18-5-4-10-23-18)22-8-2-1-3-9-22/h4-5,10,14-17H,1-3,6-9,11-13H2,(H2,20,21,24)/t14-,15-,16+,17+/m0/s1 |
| InChIKey | LGZBPXHKTXNZOJ-MWDXBVQZSA-N |
| XLogP | 3.46 |
| TPSA | 40.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.53 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|