C20H28FN3OS — CID 98425540
1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-3-[(2S)-2-(4-fluorophenyl)-2-morpholin-4-ylethyl]thiourea (PubChem CID 98425540) has the molecular formula C20H28FN3OS and a molecular weight of 377.53 g/mol. Its IUPAC name is 1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-3-[(2S)-2-(4-fluorophenyl)-2-morpholin-4-ylethyl]thiourea.
| Compound Name | 1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-3-[(2S)-2-(4-fluorophenyl)-2-morpholin-4-ylethyl]thiourea |
|---|---|
| PubChem CID | 98425540 |
| Molecular Formula | C20H28FN3OS |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | 1-[(1R,2S,4R)-2-bicyclo[2.2.1]heptanyl]-3-[(2S)-2-(4-fluorophenyl)-2-morpholin-4-ylethyl]thiourea |
| SMILES | Fc1ccc([C@@H](CNC(=S)N[C@H]2C[C@@H]3CC[C@@H]2C3)N2CCOCC2)cc1 |
| InChI | InChI=1S/C20H28FN3OS/c21-17-5-3-15(4-6-17)19(24-7-9-25-10-8-24)13-22-20(26)23-18-12-14-1-2-16(18)11-14/h3-6,14,16,18-19H,1-2,7-13H2,(H2,22,23,26)/t14-,16-,18+,19-/m1/s1 |
| InChIKey | YEABGOAQHOLJOV-SKWUIDRYSA-N |
| XLogP | 2.85 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|