C21H26ClFN4S — CID 21008716
1-(3-chloro-4-fluorophenyl)-3-[2-(4-methylphenyl)-2-(4-methylpiperazin-1-yl)ethyl]thiourea (PubChem CID 21008716) has the molecular formula C21H26ClFN4S and a molecular weight of 420.99 g/mol. Its IUPAC name is 1-(3-chloro-4-fluorophenyl)-3-[2-(4-methylphenyl)-2-(4-methylpiperazin-1-yl)ethyl]thiourea.
| Compound Name | 1-(3-chloro-4-fluorophenyl)-3-[2-(4-methylphenyl)-2-(4-methylpiperazin-1-yl)ethyl]thiourea |
|---|---|
| PubChem CID | 21008716 |
| Molecular Formula | C21H26ClFN4S |
| Molecular Weight | 420.99 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 1-(3-chloro-4-fluorophenyl)-3-[2-(4-methylphenyl)-2-(4-methylpiperazin-1-yl)ethyl]thiourea |
| SMILES | Cc1ccc(C(CNC(=S)Nc2ccc(F)c(Cl)c2)N2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C21H26ClFN4S/c1-15-3-5-16(6-4-15)20(27-11-9-26(2)10-12-27)14-24-21(28)25-17-7-8-19(23)18(22)13-17/h3-8,13,20H,9-12,14H2,1-2H3,(H2,24,25,28) |
| InChIKey | LABIBAKQAGBCET-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.99 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|