C12H22F3N3S — CID 111997299
2-methyl-1-(3-methylsulfanylcyclohexyl)-3-(3,3,3-trifluoropropyl)guanidine (PubChem CID 111997299) has the molecular formula C12H22F3N3S and a molecular weight of 297.39 g/mol. Its IUPAC name is 2-methyl-1-(3-methylsulfanylcyclohexyl)-3-(3,3,3-trifluoropropyl)guanidine.
| Compound Name | 2-methyl-1-(3-methylsulfanylcyclohexyl)-3-(3,3,3-trifluoropropyl)guanidine |
|---|---|
| PubChem CID | 111997299 |
| Molecular Formula | C12H22F3N3S |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 2-methyl-1-(3-methylsulfanylcyclohexyl)-3-(3,3,3-trifluoropropyl)guanidine |
| SMILES | C/N=C(\NCCC(F)(F)F)NC1CCCC(SC)C1 |
| InChI | InChI=1S/C12H22F3N3S/c1-16-11(17-7-6-12(13,14)15)18-9-4-3-5-10(8-9)19-2/h9-10H,3-8H2,1-2H3,(H2,16,17,18) |
| InChIKey | ZKCKWODXOUJXPK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|