C13H26N4O3 — CID 110285196
2-(diethylcarbamoylamino)-N-(2-morpholin-4-ylethyl)acetamide (PubChem CID 110285196) has the molecular formula C13H26N4O3 and a molecular weight of 286.38 g/mol. Its IUPAC name is 2-(diethylcarbamoylamino)-N-(2-morpholin-4-ylethyl)acetamide.
| Compound Name | 2-(diethylcarbamoylamino)-N-(2-morpholin-4-ylethyl)acetamide |
|---|---|
| PubChem CID | 110285196 |
| Molecular Formula | C13H26N4O3 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | 2-(diethylcarbamoylamino)-N-(2-morpholin-4-ylethyl)acetamide |
| SMILES | CCN(CC)C(=O)NCC(=O)NCCN1CCOCC1 |
| InChI | InChI=1S/C13H26N4O3/c1-3-17(4-2)13(19)15-11-12(18)14-5-6-16-7-9-20-10-8-16/h3-11H2,1-2H3,(H,14,18)(H,15,19) |
| InChIKey | DUWOAWONJRLLOO-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |