C14H30N4O — CID 63168286
N',N'-dimethyl-N-[2-(3-morpholin-4-ylpyrrolidin-1-yl)ethyl]ethane-1,2-diamine (PubChem CID 63168286) has the molecular formula C14H30N4O and a molecular weight of 270.42 g/mol. Its IUPAC name is N',N'-dimethyl-N-[2-(3-morpholin-4-ylpyrrolidin-1-yl)ethyl]ethane-1,2-diamine.
| Compound Name | N',N'-dimethyl-N-[2-(3-morpholin-4-ylpyrrolidin-1-yl)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 63168286 |
| Molecular Formula | C14H30N4O |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.24 |
| IUPAC Name | N',N'-dimethyl-N-[2-(3-morpholin-4-ylpyrrolidin-1-yl)ethyl]ethane-1,2-diamine |
| SMILES | CN(C)CCNCCN1CCC(N2CCOCC2)C1 |
| InChI | InChI=1S/C14H30N4O/c1-16(2)7-4-15-5-8-17-6-3-14(13-17)18-9-11-19-12-10-18/h14-15H,3-13H2,1-2H3 |
| InChIKey | ZUVMKDGLECXLOW-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 30.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|