C13H26N4O — CID 10923093
N,N-dimethyl-3-(3-morpholin-4-ylpropyliminomethylideneamino)propan-1-amine (PubChem CID 10923093) has the molecular formula C13H26N4O and a molecular weight of 254.38 g/mol. Its IUPAC name is N,N-dimethyl-3-(3-morpholin-4-ylpropyliminomethylideneamino)propan-1-amine.
| Compound Name | N,N-dimethyl-3-(3-morpholin-4-ylpropyliminomethylideneamino)propan-1-amine |
|---|---|
| PubChem CID | 10923093 |
| Molecular Formula | C13H26N4O |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.21 |
| IUPAC Name | N,N-dimethyl-3-(3-morpholin-4-ylpropyliminomethylideneamino)propan-1-amine |
| SMILES | CN(C)CCCN=C=NCCCN1CCOCC1 |
| InChI | InChI=1S/C13H26N4O/c1-16(2)7-3-5-14-13-15-6-4-8-17-9-11-18-12-10-17/h3-12H2,1-2H3 |
| InChIKey | QPXHBJHJPXJQMA-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 40.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|