C15H32N2O — CID 142218113
N,N-diethyl-3-methyl-6-morpholin-4-ylhexan-1-amine (PubChem CID 142218113) has the molecular formula C15H32N2O and a molecular weight of 256.43 g/mol. Its IUPAC name is N,N-diethyl-3-methyl-6-morpholin-4-ylhexan-1-amine.
| Compound Name | N,N-diethyl-3-methyl-6-morpholin-4-ylhexan-1-amine |
|---|---|
| PubChem CID | 142218113 |
| Molecular Formula | C15H32N2O |
| Molecular Weight | 256.43 g/mol |
| Exact Mass | 256.25 |
| IUPAC Name | N,N-diethyl-3-methyl-6-morpholin-4-ylhexan-1-amine |
| SMILES | CCN(CC)CCC(C)CCCN1CCOCC1 |
| InChI | InChI=1S/C15H32N2O/c1-4-16(5-2)10-8-15(3)7-6-9-17-11-13-18-14-12-17/h15H,4-14H2,1-3H3 |
| InChIKey | NHSPRDPUUSGUMX-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.43 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |