C23H33N3OS — CID 8659923
1-[4-(1-adamantyl)phenyl]-3-(2-morpholin-4-ylethyl)thiourea (PubChem CID 8659923) has the molecular formula C23H33N3OS and a molecular weight of 399.60 g/mol. Its IUPAC name is 1-[4-(1-adamantyl)phenyl]-3-(2-morpholin-4-ylethyl)thiourea.
| Compound Name | 1-[4-(1-adamantyl)phenyl]-3-(2-morpholin-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 8659923 |
| Molecular Formula | C23H33N3OS |
| Molecular Weight | 399.60 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | 1-[4-(1-adamantyl)phenyl]-3-(2-morpholin-4-ylethyl)thiourea |
| SMILES | S=C(NCCN1CCOCC1)Nc1ccc(C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C23H33N3OS/c28-22(24-5-6-26-7-9-27-10-8-26)25-21-3-1-20(2-4-21)23-14-17-11-18(15-23)13-19(12-17)16-23/h1-4,17-19H,5-16H2,(H2,24,25,28) |
| InChIKey | ZIENLZRQTLOCJW-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.60 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|