C23H25ClN2S — CID 100642371
1-[4-(1-adamantyl)phenyl]-3-(4-chlorophenyl)thiourea (PubChem CID 100642371) has the molecular formula C23H25ClN2S and a molecular weight of 396.99 g/mol. Its IUPAC name is 1-[4-(1-adamantyl)phenyl]-3-(4-chlorophenyl)thiourea.
| Compound Name | 1-[4-(1-adamantyl)phenyl]-3-(4-chlorophenyl)thiourea |
|---|---|
| PubChem CID | 100642371 |
| Molecular Formula | C23H25ClN2S |
| Molecular Weight | 396.99 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 1-[4-(1-adamantyl)phenyl]-3-(4-chlorophenyl)thiourea |
| SMILES | S=C(Nc1ccc(Cl)cc1)Nc1ccc(C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C23H25ClN2S/c24-19-3-7-21(8-4-19)26-22(27)25-20-5-1-18(2-6-20)23-12-15-9-16(13-23)11-17(10-15)14-23/h1-8,15-17H,9-14H2,(H2,25,26,27) |
| InChIKey | OUHMLPRNDFBEHX-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.99 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|