C20H23F4N3O — CID 156563791
4-N-(4-fluorophenyl)-1-N-(3-morpholin-4-ylpropyl)-2-(trifluoromethyl)benzene-1,4-diamine (PubChem CID 156563791) has the molecular formula C20H23F4N3O and a molecular weight of 397.42 g/mol. Its IUPAC name is 4-N-(4-fluorophenyl)-1-N-(3-morpholin-4-ylpropyl)-2-(trifluoromethyl)benzene-1,4-diamine.
| Compound Name | 4-N-(4-fluorophenyl)-1-N-(3-morpholin-4-ylpropyl)-2-(trifluoromethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 156563791 |
| Molecular Formula | C20H23F4N3O |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 4-N-(4-fluorophenyl)-1-N-(3-morpholin-4-ylpropyl)-2-(trifluoromethyl)benzene-1,4-diamine |
| SMILES | Fc1ccc(Nc2ccc(NCCCN3CCOCC3)c(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C20H23F4N3O/c21-15-2-4-16(5-3-15)26-17-6-7-19(18(14-17)20(22,23)24)25-8-1-9-27-10-12-28-13-11-27/h2-7,14,25-26H,1,8-13H2 |
| InChIKey | IGCWFPSHEGAAFS-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 36.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|