C16H23F3N4O2 — CID 151612984
[4-[(3-morpholin-4-ylpropylamino)methyl]-3-(trifluoromethyl)phenyl]urea (PubChem CID 151612984) has the molecular formula C16H23F3N4O2 and a molecular weight of 360.38 g/mol. Its IUPAC name is [4-[(3-morpholin-4-ylpropylamino)methyl]-3-(trifluoromethyl)phenyl]urea.
| Compound Name | [4-[(3-morpholin-4-ylpropylamino)methyl]-3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 151612984 |
| Molecular Formula | C16H23F3N4O2 |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | [4-[(3-morpholin-4-ylpropylamino)methyl]-3-(trifluoromethyl)phenyl]urea |
| SMILES | NC(=O)Nc1ccc(CNCCCN2CCOCC2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H23F3N4O2/c17-16(18,19)14-10-13(22-15(20)24)3-2-12(14)11-21-4-1-5-23-6-8-25-9-7-23/h2-3,10,21H,1,4-9,11H2,(H3,20,22,24) |
| InChIKey | QMXAZMWCABONLW-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|