C12H15N5O2 — CID 113332898
methyl 2-amino-3-[(4-methyl-1,2,4-triazol-3-yl)methylamino]benzoate (PubChem CID 113332898) has the molecular formula C12H15N5O2 and a molecular weight of 261.29 g/mol. Its IUPAC name is methyl 2-amino-3-[(4-methyl-1,2,4-triazol-3-yl)methylamino]benzoate.
| Compound Name | methyl 2-amino-3-[(4-methyl-1,2,4-triazol-3-yl)methylamino]benzoate |
|---|---|
| PubChem CID | 113332898 |
| Molecular Formula | C12H15N5O2 |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | methyl 2-amino-3-[(4-methyl-1,2,4-triazol-3-yl)methylamino]benzoate |
| SMILES | COC(=O)c1cccc(NCc2nncn2C)c1N |
| InChI | InChI=1S/C12H15N5O2/c1-17-7-15-16-10(17)6-14-9-5-3-4-8(11(9)13)12(18)19-2/h3-5,7,14H,6,13H2,1-2H3 |
| InChIKey | YZDPFXLUVNYDJA-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|