C11H14N6O — CID 112578762
3-amino-2-[(4-methyl-1,2,4-triazol-3-yl)methylamino]benzamide (PubChem CID 112578762) has the molecular formula C11H14N6O and a molecular weight of 246.27 g/mol. Its IUPAC name is 3-amino-2-[(4-methyl-1,2,4-triazol-3-yl)methylamino]benzamide.
| Compound Name | 3-amino-2-[(4-methyl-1,2,4-triazol-3-yl)methylamino]benzamide |
|---|---|
| PubChem CID | 112578762 |
| Molecular Formula | C11H14N6O |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 3-amino-2-[(4-methyl-1,2,4-triazol-3-yl)methylamino]benzamide |
| SMILES | Cn1cnnc1CNc1c(N)cccc1C(N)=O |
| InChI | InChI=1S/C11H14N6O/c1-17-6-15-16-9(17)5-14-10-7(11(13)18)3-2-4-8(10)12/h2-4,6,14H,5,12H2,1H3,(H2,13,18) |
| InChIKey | XOAULULSWUODTD-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 111.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|