C13H17N5O2 — CID 115934791
ethyl 3-amino-2-[(4-methyl-1,2,4-triazol-3-yl)methylamino]benzoate (PubChem CID 115934791) has the molecular formula C13H17N5O2 and a molecular weight of 275.31 g/mol. Its IUPAC name is ethyl 3-amino-2-[(4-methyl-1,2,4-triazol-3-yl)methylamino]benzoate.
| Compound Name | ethyl 3-amino-2-[(4-methyl-1,2,4-triazol-3-yl)methylamino]benzoate |
|---|---|
| PubChem CID | 115934791 |
| Molecular Formula | C13H17N5O2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | ethyl 3-amino-2-[(4-methyl-1,2,4-triazol-3-yl)methylamino]benzoate |
| SMILES | CCOC(=O)c1cccc(N)c1NCc1nncn1C |
| InChI | InChI=1S/C13H17N5O2/c1-3-20-13(19)9-5-4-6-10(14)12(9)15-7-11-17-16-8-18(11)2/h4-6,8,15H,3,7,14H2,1-2H3 |
| InChIKey | JKWRZTLZGYYMOG-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|