C12H11F2N3S2 — CID 107934717
2,3-difluoro-4-[(2-methyl-1,3-thiazol-5-yl)methylamino]benzenecarbothioamide (PubChem CID 107934717) has the molecular formula C12H11F2N3S2 and a molecular weight of 299.37 g/mol. Its IUPAC name is 2,3-difluoro-4-[(2-methyl-1,3-thiazol-5-yl)methylamino]benzenecarbothioamide.
| Compound Name | 2,3-difluoro-4-[(2-methyl-1,3-thiazol-5-yl)methylamino]benzenecarbothioamide |
|---|---|
| PubChem CID | 107934717 |
| Molecular Formula | C12H11F2N3S2 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 2,3-difluoro-4-[(2-methyl-1,3-thiazol-5-yl)methylamino]benzenecarbothioamide |
| SMILES | Cc1ncc(CNc2ccc(C(N)=S)c(F)c2F)s1 |
| InChI | InChI=1S/C12H11F2N3S2/c1-6-16-4-7(19-6)5-17-9-3-2-8(12(15)18)10(13)11(9)14/h2-4,17H,5H2,1H3,(H2,15,18) |
| InChIKey | ZAUWJNJVYWUYPI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|