C15H23F2N3 — CID 63736165
2-(difluoromethyl)-1-N-(2-piperidin-1-ylpropyl)benzene-1,4-diamine (PubChem CID 63736165) has the molecular formula C15H23F2N3 and a molecular weight of 283.37 g/mol. Its IUPAC name is 2-(difluoromethyl)-1-N-(2-piperidin-1-ylpropyl)benzene-1,4-diamine.
| Compound Name | 2-(difluoromethyl)-1-N-(2-piperidin-1-ylpropyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 63736165 |
| Molecular Formula | C15H23F2N3 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 2-(difluoromethyl)-1-N-(2-piperidin-1-ylpropyl)benzene-1,4-diamine |
| SMILES | CC(CNc1ccc(N)cc1C(F)F)N1CCCCC1 |
| InChI | InChI=1S/C15H23F2N3/c1-11(20-7-3-2-4-8-20)10-19-14-6-5-12(18)9-13(14)15(16)17/h5-6,9,11,15,19H,2-4,7-8,10,18H2,1H3 |
| InChIKey | JDHLPYHARRJMAJ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|