C16H27N3O — CID 80740126
5-ethoxy-3-N-(2-piperidin-1-ylpropyl)benzene-1,3-diamine (PubChem CID 80740126) has the molecular formula C16H27N3O and a molecular weight of 277.41 g/mol. Its IUPAC name is 5-ethoxy-3-N-(2-piperidin-1-ylpropyl)benzene-1,3-diamine.
| Compound Name | 5-ethoxy-3-N-(2-piperidin-1-ylpropyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 80740126 |
| Molecular Formula | C16H27N3O |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | 5-ethoxy-3-N-(2-piperidin-1-ylpropyl)benzene-1,3-diamine |
| SMILES | CCOc1cc(N)cc(NCC(C)N2CCCCC2)c1 |
| InChI | InChI=1S/C16H27N3O/c1-3-20-16-10-14(17)9-15(11-16)18-12-13(2)19-7-5-4-6-8-19/h9-11,13,18H,3-8,12,17H2,1-2H3 |
| InChIKey | UTNNAZVNKOVVNI-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|