C16H28N2O — CID 83142729
5-propoxy-3-N-(2,3,3-trimethylbutyl)benzene-1,3-diamine (PubChem CID 83142729) has the molecular formula C16H28N2O and a molecular weight of 264.41 g/mol. Its IUPAC name is 5-propoxy-3-N-(2,3,3-trimethylbutyl)benzene-1,3-diamine.
| Compound Name | 5-propoxy-3-N-(2,3,3-trimethylbutyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 83142729 |
| Molecular Formula | C16H28N2O |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.22 |
| IUPAC Name | 5-propoxy-3-N-(2,3,3-trimethylbutyl)benzene-1,3-diamine |
| SMILES | CCCOc1cc(N)cc(NCC(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C16H28N2O/c1-6-7-19-15-9-13(17)8-14(10-15)18-11-12(2)16(3,4)5/h8-10,12,18H,6-7,11,17H2,1-5H3 |
| InChIKey | UVHMRPHVVPBEFT-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|