C12H17F3N2O — CID 80734994
5-propoxy-3-N-(3,3,3-trifluoropropyl)benzene-1,3-diamine (PubChem CID 80734994) has the molecular formula C12H17F3N2O and a molecular weight of 262.27 g/mol. Its IUPAC name is 5-propoxy-3-N-(3,3,3-trifluoropropyl)benzene-1,3-diamine.
| Compound Name | 5-propoxy-3-N-(3,3,3-trifluoropropyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 80734994 |
| Molecular Formula | C12H17F3N2O |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 5-propoxy-3-N-(3,3,3-trifluoropropyl)benzene-1,3-diamine |
| SMILES | CCCOc1cc(N)cc(NCCC(F)(F)F)c1 |
| InChI | InChI=1S/C12H17F3N2O/c1-2-5-18-11-7-9(16)6-10(8-11)17-4-3-12(13,14)15/h6-8,17H,2-5,16H2,1H3 |
| InChIKey | ISMGVUQNKRZOOI-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|