C16H18F2N2O — CID 80738657
3-N-[(3,4-difluorophenyl)methyl]-5-propoxybenzene-1,3-diamine (PubChem CID 80738657) has the molecular formula C16H18F2N2O and a molecular weight of 292.33 g/mol. Its IUPAC name is 3-N-[(3,4-difluorophenyl)methyl]-5-propoxybenzene-1,3-diamine.
| Compound Name | 3-N-[(3,4-difluorophenyl)methyl]-5-propoxybenzene-1,3-diamine |
|---|---|
| PubChem CID | 80738657 |
| Molecular Formula | C16H18F2N2O |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 3-N-[(3,4-difluorophenyl)methyl]-5-propoxybenzene-1,3-diamine |
| SMILES | CCCOc1cc(N)cc(NCc2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C16H18F2N2O/c1-2-5-21-14-8-12(19)7-13(9-14)20-10-11-3-4-15(17)16(18)6-11/h3-4,6-9,20H,2,5,10,19H2,1H3 |
| InChIKey | HLRWNENROWFDNF-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|