C14H17BrN2OS — CID 80735575
3-N-[(5-bromothiophen-2-yl)methyl]-5-propoxybenzene-1,3-diamine (PubChem CID 80735575) has the molecular formula C14H17BrN2OS and a molecular weight of 341.27 g/mol. Its IUPAC name is 3-N-[(5-bromothiophen-2-yl)methyl]-5-propoxybenzene-1,3-diamine.
| Compound Name | 3-N-[(5-bromothiophen-2-yl)methyl]-5-propoxybenzene-1,3-diamine |
|---|---|
| PubChem CID | 80735575 |
| Molecular Formula | C14H17BrN2OS |
| Molecular Weight | 341.27 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | 3-N-[(5-bromothiophen-2-yl)methyl]-5-propoxybenzene-1,3-diamine |
| SMILES | CCCOc1cc(N)cc(NCc2ccc(Br)s2)c1 |
| InChI | InChI=1S/C14H17BrN2OS/c1-2-5-18-12-7-10(16)6-11(8-12)17-9-13-3-4-14(15)19-13/h3-4,6-8,17H,2,5,9,16H2,1H3 |
| InChIKey | MNJASKYMXUVPEK-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.27 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|