C15H21N3O2 — CID 106369566
3-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-5-propoxybenzene-1,3-diamine (PubChem CID 106369566) has the molecular formula C15H21N3O2 and a molecular weight of 275.35 g/mol. Its IUPAC name is 3-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-5-propoxybenzene-1,3-diamine.
| Compound Name | 3-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-5-propoxybenzene-1,3-diamine |
|---|---|
| PubChem CID | 106369566 |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | 3-N-[(5-ethyl-1,3-oxazol-2-yl)methyl]-5-propoxybenzene-1,3-diamine |
| SMILES | CCCOc1cc(N)cc(NCc2ncc(CC)o2)c1 |
| InChI | InChI=1S/C15H21N3O2/c1-3-5-19-14-7-11(16)6-12(8-14)17-10-15-18-9-13(4-2)20-15/h6-9,17H,3-5,10,16H2,1-2H3 |
| InChIKey | LQMNMKOCOADFHO-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 73.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|