C14H23N3OS — CID 106324907
5-ethoxy-3-N-(2-thiomorpholin-4-ylethyl)benzene-1,3-diamine (PubChem CID 106324907) has the molecular formula C14H23N3OS and a molecular weight of 281.43 g/mol. Its IUPAC name is 5-ethoxy-3-N-(2-thiomorpholin-4-ylethyl)benzene-1,3-diamine.
| Compound Name | 5-ethoxy-3-N-(2-thiomorpholin-4-ylethyl)benzene-1,3-diamine |
|---|---|
| PubChem CID | 106324907 |
| Molecular Formula | C14H23N3OS |
| Molecular Weight | 281.43 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 5-ethoxy-3-N-(2-thiomorpholin-4-ylethyl)benzene-1,3-diamine |
| SMILES | CCOc1cc(N)cc(NCCN2CCSCC2)c1 |
| InChI | InChI=1S/C14H23N3OS/c1-2-18-14-10-12(15)9-13(11-14)16-3-4-17-5-7-19-8-6-17/h9-11,16H,2-8,15H2,1H3 |
| InChIKey | CWWHVZROMYONTC-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.43 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|