C13H23N3O — CID 80734963
5-ethoxy-3-N-[2-[ethyl(methyl)amino]ethyl]benzene-1,3-diamine (PubChem CID 80734963) has the molecular formula C13H23N3O and a molecular weight of 237.35 g/mol. Its IUPAC name is 5-ethoxy-3-N-[2-[ethyl(methyl)amino]ethyl]benzene-1,3-diamine.
| Compound Name | 5-ethoxy-3-N-[2-[ethyl(methyl)amino]ethyl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 80734963 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | 5-ethoxy-3-N-[2-[ethyl(methyl)amino]ethyl]benzene-1,3-diamine |
| SMILES | CCOc1cc(N)cc(NCCN(C)CC)c1 |
| InChI | InChI=1S/C13H23N3O/c1-4-16(3)7-6-15-12-8-11(14)9-13(10-12)17-5-2/h8-10,15H,4-7,14H2,1-3H3 |
| InChIKey | OIPMLYSAKRIQLC-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|