C12H19N3S — CID 106324704
4-N-(2-thiomorpholin-4-ylethyl)benzene-1,4-diamine (PubChem CID 106324704) has the molecular formula C12H19N3S and a molecular weight of 237.37 g/mol. Its IUPAC name is 4-N-(2-thiomorpholin-4-ylethyl)benzene-1,4-diamine.
| Compound Name | 4-N-(2-thiomorpholin-4-ylethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 106324704 |
| Molecular Formula | C12H19N3S |
| Molecular Weight | 237.37 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 4-N-(2-thiomorpholin-4-ylethyl)benzene-1,4-diamine |
| SMILES | Nc1ccc(NCCN2CCSCC2)cc1 |
| InChI | InChI=1S/C12H19N3S/c13-11-1-3-12(4-2-11)14-5-6-15-7-9-16-10-8-15/h1-4,14H,5-10,13H2 |
| InChIKey | RFAKSJYKYVGGGJ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.37 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|