C23H35N6+ — CID 90369191
4-N-[2-[4-[2-(4-aminoanilino)ethyl]-4-prop-2-enylpiperazin-4-ium-1-yl]ethyl]benzene-1,4-diamine (PubChem CID 90369191) has the molecular formula C23H35N6+ and a molecular weight of 395.58 g/mol. Its IUPAC name is 4-N-[2-[4-[2-(4-aminoanilino)ethyl]-4-prop-2-enylpiperazin-4-ium-1-yl]ethyl]benzene-1,4-diamine.
| Compound Name | 4-N-[2-[4-[2-(4-aminoanilino)ethyl]-4-prop-2-enylpiperazin-4-ium-1-yl]ethyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 90369191 |
| Molecular Formula | C23H35N6+ |
| Molecular Weight | 395.58 g/mol |
| Exact Mass | 395.29 |
| IUPAC Name | 4-N-[2-[4-[2-(4-aminoanilino)ethyl]-4-prop-2-enylpiperazin-4-ium-1-yl]ethyl]benzene-1,4-diamine |
| SMILES | C=CC[N+]1(CCNc2ccc(N)cc2)CCN(CCNc2ccc(N)cc2)CC1 |
| InChI | InChI=1S/C23H35N6/c1-2-16-29(17-12-27-23-9-5-21(25)6-10-23)18-14-28(15-19-29)13-11-26-22-7-3-20(24)4-8-22/h2-10,26-27H,1,11-19,24-25H2/q+1 |
| InChIKey | GODSCFCUTXOXPF-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 79.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.58 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|