C27H46N6 — CID 161114230
4-N-[3-[4-[3-(4-amino-3-methylanilino)propyl]-4-ethylpiperazin-4-ium-1-yl]propyl]-2-methylbenzene-1,4-diamine;carbanide (PubChem CID 161114230) has the molecular formula C27H46N6 and a molecular weight of 454.71 g/mol. Its IUPAC name is 4-N-[3-[4-[3-(4-amino-3-methylanilino)propyl]-4-ethylpiperazin-4-ium-1-yl]propyl]-2-methylbenzene-1,4-diamine;carbanide.
| Compound Name | 4-N-[3-[4-[3-(4-amino-3-methylanilino)propyl]-4-ethylpiperazin-4-ium-1-yl]propyl]-2-methylbenzene-1,4-diamine;carbanide |
|---|---|
| PubChem CID | 161114230 |
| Molecular Formula | C27H46N6 |
| Molecular Weight | 454.71 g/mol |
| Exact Mass | 454.38 |
| IUPAC Name | 4-N-[3-[4-[3-(4-amino-3-methylanilino)propyl]-4-ethylpiperazin-4-ium-1-yl]propyl]-2-methylbenzene-1,4-diamine;carbanide |
| SMILES | CC[N+]1(CCCNc2ccc(N)c(C)c2)CCN(CCCNc2ccc(N)c(C)c2)CC1.[CH3-] |
| InChI | InChI=1S/C26H43N6.CH3/c1-4-32(16-6-12-30-24-8-10-26(28)22(3)20-24)17-14-31(15-18-32)13-5-11-29-23-7-9-25(27)21(2)19-23;/h7-10,19-20,29-30H,4-6,11-18,27-28H2,1-3H3;1H3/q+1;-1 |
| InChIKey | UKCIDQZTANBVFG-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 79.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.71 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|