C23H36N5+ — CID 159962051
4-N-[2-[4-[3-(4-aminophenyl)propyl]-4-ethylpiperazin-4-ium-1-yl]ethyl]benzene-1,4-diamine (PubChem CID 159962051) has the molecular formula C23H36N5+ and a molecular weight of 382.58 g/mol. Its IUPAC name is 4-N-[2-[4-[3-(4-aminophenyl)propyl]-4-ethylpiperazin-4-ium-1-yl]ethyl]benzene-1,4-diamine.
| Compound Name | 4-N-[2-[4-[3-(4-aminophenyl)propyl]-4-ethylpiperazin-4-ium-1-yl]ethyl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 159962051 |
| Molecular Formula | C23H36N5+ |
| Molecular Weight | 382.58 g/mol |
| Exact Mass | 382.30 |
| IUPAC Name | 4-N-[2-[4-[3-(4-aminophenyl)propyl]-4-ethylpiperazin-4-ium-1-yl]ethyl]benzene-1,4-diamine |
| SMILES | CC[N+]1(CCCc2ccc(N)cc2)CCN(CCNc2ccc(N)cc2)CC1 |
| InChI | InChI=1S/C23H36N5/c1-2-28(17-3-4-20-5-7-21(24)8-6-20)18-15-27(16-19-28)14-13-26-23-11-9-22(25)10-12-23/h5-12,26H,2-4,13-19,24-25H2,1H3/q+1 |
| InChIKey | KPVMGKQSKFUSRM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.58 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|