C13H19ClN2S — CID 62557767
4-chloro-N-[2-(1,4-thiazepan-4-yl)ethyl]aniline (PubChem CID 62557767) has the molecular formula C13H19ClN2S and a molecular weight of 270.83 g/mol. Its IUPAC name is 4-chloro-N-[2-(1,4-thiazepan-4-yl)ethyl]aniline.
| Compound Name | 4-chloro-N-[2-(1,4-thiazepan-4-yl)ethyl]aniline |
|---|---|
| PubChem CID | 62557767 |
| Molecular Formula | C13H19ClN2S |
| Molecular Weight | 270.83 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 4-chloro-N-[2-(1,4-thiazepan-4-yl)ethyl]aniline |
| SMILES | Clc1ccc(NCCN2CCCSCC2)cc1 |
| InChI | InChI=1S/C13H19ClN2S/c14-12-2-4-13(5-3-12)15-6-8-16-7-1-10-17-11-9-16/h2-5,15H,1,6-11H2 |
| InChIKey | JINDBZZFUGSZNT-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.83 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |