C13H18N4OS — CID 106324737
2-N-(2-thiomorpholin-4-ylethyl)-1,3-benzoxazole-2,6-diamine (PubChem CID 106324737) has the molecular formula C13H18N4OS and a molecular weight of 278.38 g/mol. Its IUPAC name is 2-N-(2-thiomorpholin-4-ylethyl)-1,3-benzoxazole-2,6-diamine.
| Compound Name | 2-N-(2-thiomorpholin-4-ylethyl)-1,3-benzoxazole-2,6-diamine |
|---|---|
| PubChem CID | 106324737 |
| Molecular Formula | C13H18N4OS |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 2-N-(2-thiomorpholin-4-ylethyl)-1,3-benzoxazole-2,6-diamine |
| SMILES | Nc1ccc2nc(NCCN3CCSCC3)oc2c1 |
| InChI | InChI=1S/C13H18N4OS/c14-10-1-2-11-12(9-10)18-13(16-11)15-3-4-17-5-7-19-8-6-17/h1-2,9H,3-8,14H2,(H,15,16) |
| InChIKey | HTGFUAOCZBBERZ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 67.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|