C14H18N4O3 — CID 116690841
2-(2-piperazin-1-ylethylamino)-1,3-benzoxazole-6-carboxylic acid (PubChem CID 116690841) has the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is 2-(2-piperazin-1-ylethylamino)-1,3-benzoxazole-6-carboxylic acid.
| Compound Name | 2-(2-piperazin-1-ylethylamino)-1,3-benzoxazole-6-carboxylic acid |
|---|---|
| PubChem CID | 116690841 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 2-(2-piperazin-1-ylethylamino)-1,3-benzoxazole-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2nc(NCCN3CCNCC3)oc2c1 |
| InChI | InChI=1S/C14H18N4O3/c19-13(20)10-1-2-11-12(9-10)21-14(17-11)16-5-8-18-6-3-15-4-7-18/h1-2,9,15H,3-8H2,(H,16,17)(H,19,20) |
| InChIKey | NSQXCGHWBZQENN-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |