C12H12N2O3 — CID 116691651
2-(but-3-enylamino)-1,3-benzoxazole-6-carboxylic acid (PubChem CID 116691651) has the molecular formula C12H12N2O3 and a molecular weight of 232.24 g/mol. Its IUPAC name is 2-(but-3-enylamino)-1,3-benzoxazole-6-carboxylic acid.
| Compound Name | 2-(but-3-enylamino)-1,3-benzoxazole-6-carboxylic acid |
|---|---|
| PubChem CID | 116691651 |
| Molecular Formula | C12H12N2O3 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 2-(but-3-enylamino)-1,3-benzoxazole-6-carboxylic acid |
| SMILES | C=CCCNc1nc2ccc(C(=O)O)cc2o1 |
| InChI | InChI=1S/C12H12N2O3/c1-2-3-6-13-12-14-9-5-4-8(11(15)16)7-10(9)17-12/h2,4-5,7H,1,3,6H2,(H,13,14)(H,15,16) |
| InChIKey | UGWXOEVGQDLJNS-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|