C13H15N5O — CID 106104020
2-N-[2-(1-methylpyrazol-3-yl)ethyl]-1,3-benzoxazole-2,6-diamine (PubChem CID 106104020) has the molecular formula C13H15N5O and a molecular weight of 257.30 g/mol. Its IUPAC name is 2-N-[2-(1-methylpyrazol-3-yl)ethyl]-1,3-benzoxazole-2,6-diamine.
| Compound Name | 2-N-[2-(1-methylpyrazol-3-yl)ethyl]-1,3-benzoxazole-2,6-diamine |
|---|---|
| PubChem CID | 106104020 |
| Molecular Formula | C13H15N5O |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 2-N-[2-(1-methylpyrazol-3-yl)ethyl]-1,3-benzoxazole-2,6-diamine |
| SMILES | Cn1ccc(CCNc2nc3ccc(N)cc3o2)n1 |
| InChI | InChI=1S/C13H15N5O/c1-18-7-5-10(17-18)4-6-15-13-16-11-3-2-9(14)8-12(11)19-13/h2-3,5,7-8H,4,6,14H2,1H3,(H,15,16) |
| InChIKey | XHMAVTMHKWPSAS-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 81.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|