C12H15N3O — CID 106182241
2-N-(3-methylbut-2-enyl)-1,3-benzoxazole-2,6-diamine (PubChem CID 106182241) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is 2-N-(3-methylbut-2-enyl)-1,3-benzoxazole-2,6-diamine.
| Compound Name | 2-N-(3-methylbut-2-enyl)-1,3-benzoxazole-2,6-diamine |
|---|---|
| PubChem CID | 106182241 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 2-N-(3-methylbut-2-enyl)-1,3-benzoxazole-2,6-diamine |
| SMILES | CC(C)=CCNc1nc2ccc(N)cc2o1 |
| InChI | InChI=1S/C12H15N3O/c1-8(2)5-6-14-12-15-10-4-3-9(13)7-11(10)16-12/h3-5,7H,6,13H2,1-2H3,(H,14,15) |
| InChIKey | ZHBORPNSYCYKIL-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|