C12H17N3O3S — CID 79893031
2-N-(2-methyl-2-methylsulfonylpropyl)-1,3-benzoxazole-2,6-diamine (PubChem CID 79893031) has the molecular formula C12H17N3O3S and a molecular weight of 283.35 g/mol. Its IUPAC name is 2-N-(2-methyl-2-methylsulfonylpropyl)-1,3-benzoxazole-2,6-diamine.
| Compound Name | 2-N-(2-methyl-2-methylsulfonylpropyl)-1,3-benzoxazole-2,6-diamine |
|---|---|
| PubChem CID | 79893031 |
| Molecular Formula | C12H17N3O3S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 2-N-(2-methyl-2-methylsulfonylpropyl)-1,3-benzoxazole-2,6-diamine |
| SMILES | CC(C)(CNc1nc2ccc(N)cc2o1)S(C)(=O)=O |
| InChI | InChI=1S/C12H17N3O3S/c1-12(2,19(3,16)17)7-14-11-15-9-5-4-8(13)6-10(9)18-11/h4-6H,7,13H2,1-3H3,(H,14,15) |
| InChIKey | HPSFPAKBSDZYNR-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|