C13H17N3O2 — CID 79892875
1-[[(6-amino-1,3-benzoxazol-2-yl)amino]methyl]cyclopentan-1-ol (PubChem CID 79892875) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is 1-[[(6-amino-1,3-benzoxazol-2-yl)amino]methyl]cyclopentan-1-ol.
| Compound Name | 1-[[(6-amino-1,3-benzoxazol-2-yl)amino]methyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 79892875 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 1-[[(6-amino-1,3-benzoxazol-2-yl)amino]methyl]cyclopentan-1-ol |
| SMILES | Nc1ccc2nc(NCC3(O)CCCC3)oc2c1 |
| InChI | InChI=1S/C13H17N3O2/c14-9-3-4-10-11(7-9)18-12(16-10)15-8-13(17)5-1-2-6-13/h3-4,7,17H,1-2,5-6,8,14H2,(H,15,16) |
| InChIKey | OXAQXXQJGDRBHK-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 84.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|