C10H13N5O2 — CID 83116991
2-[(6-amino-1,3-benzoxazol-2-yl)amino]ethylurea (PubChem CID 83116991) has the molecular formula C10H13N5O2 and a molecular weight of 235.25 g/mol. Its IUPAC name is 2-[(6-amino-1,3-benzoxazol-2-yl)amino]ethylurea.
| Compound Name | 2-[(6-amino-1,3-benzoxazol-2-yl)amino]ethylurea |
|---|---|
| PubChem CID | 83116991 |
| Molecular Formula | C10H13N5O2 |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 2-[(6-amino-1,3-benzoxazol-2-yl)amino]ethylurea |
| SMILES | NC(=O)NCCNc1nc2ccc(N)cc2o1 |
| InChI | InChI=1S/C10H13N5O2/c11-6-1-2-7-8(5-6)17-10(15-7)14-4-3-13-9(12)16/h1-2,5H,3-4,11H2,(H,14,15)(H3,12,13,16) |
| InChIKey | MRAITOOYOWXCGL-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 119.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|